C27H31Cl2N3O2 — CID 44533700
(E)-N-[(3S)-1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]pyrrolidin-3-yl]-3-phenylprop-2-enamide (PubChem CID 44533700) has the molecular formula C27H31Cl2N3O2 and a molecular weight of 500.47 g/mol. Its IUPAC name is (E)-N-[(3S)-1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]pyrrolidin-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(3S)-1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]pyrrolidin-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 44533700 |
| Molecular Formula | C27H31Cl2N3O2 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | (E)-N-[(3S)-1-[5-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]pentyl]pyrrolidin-3-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CC[C@H](NC(=O)/C=C/c2ccccc2)C1 |
| InChI | InChI=1S/C27H31Cl2N3O2/c28-24-12-9-22(19-25(24)29)11-13-26(33)30-16-5-2-6-17-32-18-15-23(20-32)31-27(34)14-10-21-7-3-1-4-8-21/h1,3-4,7-14,19,23H,2,5-6,15-18,20H2,(H,30,33)(H,31,34)/b13-11+,14-10+/t23-/m0/s1 |
| InChIKey | HEHXADVQZWNADQ-ARCUIZILSA-N |
| XLogP | 5.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|