C30H37Cl2N3O2 — CID 44533705
(E)-N-[2-[1-[5-[3-(3,4-dichlorophenyl)prop-2-enoylamino]pentyl]piperidin-4-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 44533705) has the molecular formula C30H37Cl2N3O2 and a molecular weight of 542.55 g/mol. Its IUPAC name is (E)-N-[2-[1-[5-[3-(3,4-dichlorophenyl)prop-2-enoylamino]pentyl]piperidin-4-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[1-[5-[3-(3,4-dichlorophenyl)prop-2-enoylamino]pentyl]piperidin-4-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 44533705 |
| Molecular Formula | C30H37Cl2N3O2 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | (E)-N-[2-[1-[5-[3-(3,4-dichlorophenyl)prop-2-enoylamino]pentyl]piperidin-4-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(CCNC(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C30H37Cl2N3O2/c31-27-12-9-26(23-28(27)32)11-14-29(36)33-18-5-2-6-20-35-21-16-25(17-22-35)15-19-34-30(37)13-10-24-7-3-1-4-8-24/h1,3-4,7-14,23,25H,2,5-6,15-22H2,(H,33,36)(H,34,37)/b13-10+,14-11? |
| InChIKey | XWLZXMSZXWJONT-PEELMVAHSA-N |
| XLogP | 6.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|