C29H36Cl2F3N3O3S — CID 44533730
3-(3,4-dichlorophenyl)-N-[5-[4-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propyl]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44533730) has the molecular formula C29H36Cl2F3N3O3S and a molecular weight of 634.59 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[5-[4-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propyl]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[5-[4-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propyl]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44533730 |
| Molecular Formula | C29H36Cl2F3N3O3S |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 633.18 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[5-[4-[3-[[3-(trifluoromethyl)phenyl]sulfonylamino]propyl]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(CCCNS(=O)(=O)c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C29H36Cl2F3N3O3S/c30-26-11-9-23(20-27(26)31)10-12-28(38)35-15-2-1-3-17-37-18-13-22(14-19-37)6-5-16-36-41(39,40)25-8-4-7-24(21-25)29(32,33)34/h4,7-12,20-22,36H,1-3,5-6,13-19H2,(H,35,38) |
| InChIKey | WUOUCPPKKSJTJL-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|