C27H32Cl2F3N3O3S — CID 44533736
(E)-3-(3,4-dichlorophenyl)-N-[5-[3-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44533736) has the molecular formula C27H32Cl2F3N3O3S and a molecular weight of 606.54 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[3-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[3-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44533736 |
| Molecular Formula | C27H32Cl2F3N3O3S |
| Molecular Weight | 606.54 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[3-[[[3-(trifluoromethyl)phenyl]sulfonylamino]methyl]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCCC(CNS(=O)(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C27H32Cl2F3N3O3S/c28-24-11-9-20(16-25(24)29)10-12-26(36)33-13-2-1-3-14-35-15-5-6-21(19-35)18-34-39(37,38)23-8-4-7-22(17-23)27(30,31)32/h4,7-12,16-17,21,34H,1-3,5-6,13-15,18-19H2,(H,33,36)/b12-10+ |
| InChIKey | RXEVELWDBBDFGK-ZRDIBKRKSA-N |
| XLogP | 6.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|