C40H46F3N3O3 — CID 44533763
N-butyl-5-[(cyclohexylamino)methyl]-2-[3-[[(4-phenylphenyl)methylamino]methyl]phenyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 44533763) has the molecular formula C40H46F3N3O3 and a molecular weight of 673.82 g/mol. Its IUPAC name is N-butyl-5-[(cyclohexylamino)methyl]-2-[3-[[(4-phenylphenyl)methylamino]methyl]phenyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-5-[(cyclohexylamino)methyl]-2-[3-[[(4-phenylphenyl)methylamino]methyl]phenyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44533763 |
| Molecular Formula | C40H46F3N3O3 |
| Molecular Weight | 673.82 g/mol |
| Exact Mass | 673.35 |
| IUPAC Name | N-butyl-5-[(cyclohexylamino)methyl]-2-[3-[[(4-phenylphenyl)methylamino]methyl]phenyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)c1cc(CNC2CCCCC2)ccc1-c1cccc(CNCc2ccc(-c3ccccc3)cc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C38H45N3O.C2HF3O2/c1-2-3-23-40-38(42)37-25-31(28-41-35-15-8-5-9-16-35)19-22-36(37)34-14-10-11-30(24-34)27-39-26-29-17-20-33(21-18-29)32-12-6-4-7-13-32;3-2(4,5)1(6)7/h4,6-7,10-14,17-22,24-25,35,39,41H,2-3,5,8-9,15-16,23,26-28H2,1H3,(H,40,42);(H,6,7) |
| InChIKey | XZADKSATOWRPQP-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.82 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|