C17H17Br3ClN3OS — CID 44533803
2-[3-[(3,4,5-tribromothiophen-2-yl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride (PubChem CID 44533803) has the molecular formula C17H17Br3ClN3OS and a molecular weight of 586.58 g/mol. Its IUPAC name is 2-[3-[(3,4,5-tribromothiophen-2-yl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride.
| Compound Name | 2-[3-[(3,4,5-tribromothiophen-2-yl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 44533803 |
| Molecular Formula | C17H17Br3ClN3OS |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 582.83 |
| IUPAC Name | 2-[3-[(3,4,5-tribromothiophen-2-yl)methylamino]propylamino]-1H-quinolin-4-one;hydrochloride |
| SMILES | Cl.O=c1cc(NCCCNCc2sc(Br)c(Br)c2Br)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H16Br3N3OS.ClH/c18-15-13(25-17(20)16(15)19)9-21-6-3-7-22-14-8-12(24)10-4-1-2-5-11(10)23-14;/h1-2,4-5,8,21H,3,6-7,9H2,(H2,22,23,24);1H |
| InChIKey | DQXVQQPHJIHGSJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|