C18H22Cl2N8 — CID 44533919
4-N-[(3,4-dichlorophenyl)methyl]-6-N-[2-(1H-imidazol-5-yl)ethyl]-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 44533919) has the molecular formula C18H22Cl2N8 and a molecular weight of 421.34 g/mol. Its IUPAC name is 4-N-[(3,4-dichlorophenyl)methyl]-6-N-[2-(1H-imidazol-5-yl)ethyl]-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[(3,4-dichlorophenyl)methyl]-6-N-[2-(1H-imidazol-5-yl)ethyl]-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 44533919 |
| Molecular Formula | C18H22Cl2N8 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-N-[(3,4-dichlorophenyl)methyl]-6-N-[2-(1H-imidazol-5-yl)ethyl]-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)Nc1nc(NCCc2cnc[nH]2)nc(NCc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C18H22Cl2N8/c1-11(2)25-18-27-16(22-6-5-13-9-21-10-24-13)26-17(28-18)23-8-12-3-4-14(19)15(20)7-12/h3-4,7,9-11H,5-6,8H2,1-2H3,(H,21,24)(H3,22,23,25,26,27,28) |
| InChIKey | GLOJLTPNGYHMSK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |