C36H46N4O4 — CID 44533937
N-[4-[1'-[(4-tert-butylphenyl)methyl]-5-cyclohexyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1-yl]butyl]acetamide (PubChem CID 44533937) has the molecular formula C36H46N4O4 and a molecular weight of 598.79 g/mol. Its IUPAC name is N-[4-[1'-[(4-tert-butylphenyl)methyl]-5-cyclohexyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1-yl]butyl]acetamide.
| Compound Name | N-[4-[1'-[(4-tert-butylphenyl)methyl]-5-cyclohexyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1-yl]butyl]acetamide |
|---|---|
| PubChem CID | 44533937 |
| Molecular Formula | C36H46N4O4 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | N-[4-[1'-[(4-tert-butylphenyl)methyl]-5-cyclohexyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1-yl]butyl]acetamide |
| SMILES | CC(=O)NCCCCC1NC2(C(=O)N(Cc3ccc(C(C)(C)C)cc3)c3ccccc32)C2C(=O)N(C3CCCCC3)C(=O)C12 |
| InChI | InChI=1S/C36H46N4O4/c1-23(41)37-21-11-10-15-28-30-31(33(43)40(32(30)42)26-12-6-5-7-13-26)36(38-28)27-14-8-9-16-29(27)39(34(36)44)22-24-17-19-25(20-18-24)35(2,3)4/h8-9,14,16-20,26,28,30-31,38H,5-7,10-13,15,21-22H2,1-4H3,(H,37,41) |
| InChIKey | VGVAOHKPBKEDPW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|