C40H56N4O4 — CID 44533938
N-[4-[1'-[(4-tert-butylphenyl)methyl]-5-decyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1-yl]butyl]acetamide (PubChem CID 44533938) has the molecular formula C40H56N4O4 and a molecular weight of 656.91 g/mol. Its IUPAC name is N-[4-[1'-[(4-tert-butylphenyl)methyl]-5-decyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1-yl]butyl]acetamide.
| Compound Name | N-[4-[1'-[(4-tert-butylphenyl)methyl]-5-decyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1-yl]butyl]acetamide |
|---|---|
| PubChem CID | 44533938 |
| Molecular Formula | C40H56N4O4 |
| Molecular Weight | 656.91 g/mol |
| Exact Mass | 656.43 |
| IUPAC Name | N-[4-[1'-[(4-tert-butylphenyl)methyl]-5-decyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-indole]-1-yl]butyl]acetamide |
| SMILES | CCCCCCCCCCN1C(=O)C2C(CCCCNC(C)=O)NC3(C(=O)N(Cc4ccc(C(C)(C)C)cc4)c4ccccc43)C2C1=O |
| InChI | InChI=1S/C40H56N4O4/c1-6-7-8-9-10-11-12-17-26-43-36(46)34-32(19-15-16-25-41-28(2)45)42-40(35(34)37(43)47)31-18-13-14-20-33(31)44(38(40)48)27-29-21-23-30(24-22-29)39(3,4)5/h13-14,18,20-24,32,34-35,42H,6-12,15-17,19,25-27H2,1-5H3,(H,41,45) |
| InChIKey | PTYYCKAVMVESTQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.91 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|