C34H53N3O6 — CID 44533994
4-[2-[4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]quinolin-6-yl]oxyethyl]morpholine;oxalic acid (PubChem CID 44533994) has the molecular formula C34H53N3O6 and a molecular weight of 599.81 g/mol. Its IUPAC name is 4-[2-[4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]quinolin-6-yl]oxyethyl]morpholine;oxalic acid.
| Compound Name | 4-[2-[4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]quinolin-6-yl]oxyethyl]morpholine;oxalic acid |
|---|---|
| PubChem CID | 44533994 |
| Molecular Formula | C34H53N3O6 |
| Molecular Weight | 599.81 g/mol |
| Exact Mass | 599.39 |
| IUPAC Name | 4-[2-[4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]quinolin-6-yl]oxyethyl]morpholine;oxalic acid |
| SMILES | CCCCCCCN1CCC(CCCc2ccnc3ccc(OCCN4CCOCC4)cc23)[C@@H](CC)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C32H51N3O2.C2H2O4/c1-3-5-6-7-8-17-35-18-15-28(27(4-2)26-35)10-9-11-29-14-16-33-32-13-12-30(25-31(29)32)37-24-21-34-19-22-36-23-20-34;3-1(4)2(5)6/h12-14,16,25,27-28H,3-11,15,17-24,26H2,1-2H3;(H,3,4)(H,5,6)/t27-,28?;/m0./s1 |
| InChIKey | JOQYQXSEQSSGFV-BJSSTWLPSA-N |
| XLogP | 5.74 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.81 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|