C33H54ClN3O — CID 44534002
4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]-6-(2-piperidin-4-ylethoxy)quinoline;hydrochloride (PubChem CID 44534002) has the molecular formula C33H54ClN3O and a molecular weight of 544.27 g/mol. Its IUPAC name is 4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]-6-(2-piperidin-4-ylethoxy)quinoline;hydrochloride.
| Compound Name | 4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]-6-(2-piperidin-4-ylethoxy)quinoline;hydrochloride |
|---|---|
| PubChem CID | 44534002 |
| Molecular Formula | C33H54ClN3O |
| Molecular Weight | 544.27 g/mol |
| Exact Mass | 543.40 |
| IUPAC Name | 4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]-6-(2-piperidin-4-ylethoxy)quinoline;hydrochloride |
| SMILES | CCCCCCCN1CCC(CCCc2ccnc3ccc(OCCC4CCNCC4)cc23)[C@@H](CC)C1.Cl |
| InChI | InChI=1S/C33H53N3O.ClH/c1-3-5-6-7-8-22-36-23-17-29(28(4-2)26-36)10-9-11-30-16-21-35-33-13-12-31(25-32(30)33)37-24-18-27-14-19-34-20-15-27;/h12-13,16,21,25,27-29,34H,3-11,14-15,17-20,22-24,26H2,1-2H3;1H/t28-,29?;/m0./s1 |
| InChIKey | HLXVUOGXODPCSR-MKSHZDIXSA-N |
| XLogP | 8.07 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.27 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|