C35H37Cl2N5O4 — CID 44534005
(2Z,4E)-N-[3-[4-[3-(2-anilino-2-oxoethoxy)phenyl]piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide (PubChem CID 44534005) has the molecular formula C35H37Cl2N5O4 and a molecular weight of 662.62 g/mol. Its IUPAC name is (2Z,4E)-N-[3-[4-[3-(2-anilino-2-oxoethoxy)phenyl]piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[3-[4-[3-(2-anilino-2-oxoethoxy)phenyl]piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
|---|---|
| PubChem CID | 44534005 |
| Molecular Formula | C35H37Cl2N5O4 |
| Molecular Weight | 662.62 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | (2Z,4E)-N-[3-[4-[3-(2-anilino-2-oxoethoxy)phenyl]piperazin-1-yl]propyl]-5-(5,6-dichloro-1H-indol-2-yl)-2-methoxypenta-2,4-dienamide |
| SMILES | CO/C(=C\C=C\c1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NCCCN1CCN(c2cccc(OCC(=O)Nc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C35H37Cl2N5O4/c1-45-33(13-5-10-27-20-25-21-30(36)31(37)23-32(25)39-27)35(44)38-14-7-15-41-16-18-42(19-17-41)28-11-6-12-29(22-28)46-24-34(43)40-26-8-3-2-4-9-26/h2-6,8-13,20-23,39H,7,14-19,24H2,1H3,(H,38,44)(H,40,43)/b10-5+,33-13- |
| InChIKey | GMOBBLGYRZZKCX-PONGOVJZSA-N |
| XLogP | 6.36 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|