C33H52N4O6 — CID 44534024
4-[4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]quinolin-6-yl]oxybutylurea;oxalic acid (PubChem CID 44534024) has the molecular formula C33H52N4O6 and a molecular weight of 600.80 g/mol. Its IUPAC name is 4-[4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]quinolin-6-yl]oxybutylurea;oxalic acid.
| Compound Name | 4-[4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]quinolin-6-yl]oxybutylurea;oxalic acid |
|---|---|
| PubChem CID | 44534024 |
| Molecular Formula | C33H52N4O6 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 600.39 |
| IUPAC Name | 4-[4-[3-[(3R,4R)-3-ethyl-1-heptylpiperidin-4-yl]propyl]quinolin-6-yl]oxybutylurea;oxalic acid |
| SMILES | CCCCCCCN1CCC(CCCc2ccnc3ccc(OCCCCNC(N)=O)cc23)[C@@H](CC)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C31H50N4O2.C2H2O4/c1-3-5-6-7-9-20-35-21-17-26(25(4-2)24-35)12-11-13-27-16-19-33-30-15-14-28(23-29(27)30)37-22-10-8-18-34-31(32)36;3-1(4)2(5)6/h14-16,19,23,25-26H,3-13,17-18,20-22,24H2,1-2H3,(H3,32,34,36);(H,3,4)(H,5,6)/t25-,26?;/m0./s1 |
| InChIKey | MBFXKFWWDPDTNP-XZTCEYQHSA-N |
| XLogP | 5.86 |
| TPSA | 155.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|