C29H45N3O5 — CID 44534071
1-[(3S,4R)-1-heptyl-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]-N-methylmethanamine;oxalic acid (PubChem CID 44534071) has the molecular formula C29H45N3O5 and a molecular weight of 515.70 g/mol. Its IUPAC name is 1-[(3S,4R)-1-heptyl-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]-N-methylmethanamine;oxalic acid.
| Compound Name | 1-[(3S,4R)-1-heptyl-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]-N-methylmethanamine;oxalic acid |
|---|---|
| PubChem CID | 44534071 |
| Molecular Formula | C29H45N3O5 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | 1-[(3S,4R)-1-heptyl-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]-N-methylmethanamine;oxalic acid |
| SMILES | CCCCCCCN1CC[C@@H](CCCc2ccnc3ccc(OC)cc23)[C@@H](CNC)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H43N3O.C2H2O4/c1-4-5-6-7-8-17-30-18-15-22(24(21-30)20-28-2)10-9-11-23-14-16-29-27-13-12-25(31-3)19-26(23)27;3-1(4)2(5)6/h12-14,16,19,22,24,28H,4-11,15,17-18,20-21H2,1-3H3;(H,3,4)(H,5,6)/t22-,24+;/m1./s1 |
| InChIKey | ASOLEWKBHPGIFZ-UTSIGBCTSA-N |
| XLogP | 4.85 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|