C20H24Br2N4O — CID 44534163
N'-(1H-benzimidazol-2-yl)-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]butane-1,4-diamine (PubChem CID 44534163) has the molecular formula C20H24Br2N4O and a molecular weight of 496.25 g/mol. Its IUPAC name is N'-(1H-benzimidazol-2-yl)-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]butane-1,4-diamine.
| Compound Name | N'-(1H-benzimidazol-2-yl)-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 44534163 |
| Molecular Formula | C20H24Br2N4O |
| Molecular Weight | 496.25 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | N'-(1H-benzimidazol-2-yl)-N-[(3,5-dibromo-2-ethoxyphenyl)methyl]butane-1,4-diamine |
| SMILES | CCOc1c(Br)cc(Br)cc1CNCCCCNc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H24Br2N4O/c1-2-27-19-14(11-15(21)12-16(19)22)13-23-9-5-6-10-24-20-25-17-7-3-4-8-18(17)26-20/h3-4,7-8,11-12,23H,2,5-6,9-10,13H2,1H3,(H2,24,25,26) |
| InChIKey | HDUWTXJEUXJTKM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.25 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|