C28H33Cl4N3O2 — CID 44534186
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44534186) has the molecular formula C28H33Cl4N3O2 and a molecular weight of 585.40 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44534186 |
| Molecular Formula | C28H33Cl4N3O2 |
| Molecular Weight | 585.40 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[[2-(3,4-dichlorophenyl)acetyl]-methylamino]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)C1CCN(CCCCCNC(=O)/C=C/c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C28H33Cl4N3O2/c1-34(28(37)19-21-6-9-24(30)26(32)18-21)22-11-15-35(16-12-22)14-4-2-3-13-33-27(36)10-7-20-5-8-23(29)25(31)17-20/h5-10,17-18,22H,2-4,11-16,19H2,1H3,(H,33,36)/b10-7+ |
| InChIKey | QXDNBKMFEZVSCX-JXMROGBWSA-N |
| XLogP | 6.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.40 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|