C30H35Cl4N3O2 — CID 44534198
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44534198) has the molecular formula C30H35Cl4N3O2 and a molecular weight of 611.44 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44534198 |
| Molecular Formula | C30H35Cl4N3O2 |
| Molecular Weight | 611.44 g/mol |
| Exact Mass | 609.15 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[[(E)-3-(3,4-dichlorophenyl)prop-2-enoyl]amino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(CCNC(=O)/C=C/c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C30H35Cl4N3O2/c31-25-8-4-23(20-27(25)33)6-10-29(38)35-15-2-1-3-17-37-18-13-22(14-19-37)12-16-36-30(39)11-7-24-5-9-26(32)28(34)21-24/h4-11,20-22H,1-3,12-19H2,(H,35,38)(H,36,39)/b10-6+,11-7+ |
| InChIKey | RHWPSRVVSFRADI-JMQWPVDRSA-N |
| XLogP | 7.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.44 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|