C31H35Cl2F4N3O2 — CID 44534205
(E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[[(E)-3-[2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoyl]amino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide (PubChem CID 44534205) has the molecular formula C31H35Cl2F4N3O2 and a molecular weight of 628.54 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[[(E)-3-[2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoyl]amino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[[(E)-3-[2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoyl]amino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide |
|---|---|
| PubChem CID | 44534205 |
| Molecular Formula | C31H35Cl2F4N3O2 |
| Molecular Weight | 628.54 g/mol |
| Exact Mass | 627.20 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[4-[2-[[(E)-3-[2-fluoro-5-(trifluoromethyl)phenyl]prop-2-enoyl]amino]ethyl]piperidin-1-yl]pentyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCCCN1CCC(CCNC(=O)/C=C/c2cc(C(F)(F)F)ccc2F)CC1 |
| InChI | InChI=1S/C31H35Cl2F4N3O2/c32-26-8-4-23(20-27(26)33)5-10-29(41)38-15-2-1-3-17-40-18-13-22(14-19-40)12-16-39-30(42)11-6-24-21-25(31(35,36)37)7-9-28(24)34/h4-11,20-22H,1-3,12-19H2,(H,38,41)(H,39,42)/b10-5+,11-6+ |
| InChIKey | XDSQUJOGDWPROR-YOYBCKCWSA-N |
| XLogP | 7.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.54 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|