C27H26N4O2 — CID 44534230
[8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(1-benzofuran-2-yl)methanone (PubChem CID 44534230) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(1-benzofuran-2-yl)methanone.
| Compound Name | [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 44534230 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(1-benzofuran-2-yl)methanone |
| SMILES | O=C(c1cc2ccccc2o1)N1CCc2cc3nccc(N4CCN5CCC[C@H]5C4)c3cc21 |
| InChI | InChI=1S/C27H26N4O2/c32-27(26-15-19-4-1-2-6-25(19)33-26)31-11-8-18-14-22-21(16-24(18)31)23(7-9-28-22)30-13-12-29-10-3-5-20(29)17-30/h1-2,4,6-7,9,14-16,20H,3,5,8,10-13,17H2/t20-/m0/s1 |
| InChIKey | QQFUXASKPHTHSX-FQEVSTJZSA-N |
| XLogP | 4.47 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |