C24H27N5O2 — CID 44534234
[8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(3,5-dimethyl-1,2-oxazol-4-yl)methanone (PubChem CID 44534234) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(3,5-dimethyl-1,2-oxazol-4-yl)methanone.
| Compound Name | [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(3,5-dimethyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 44534234 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(3,5-dimethyl-1,2-oxazol-4-yl)methanone |
| SMILES | Cc1noc(C)c1C(=O)N1CCc2cc3nccc(N4CCN5CCC[C@H]5C4)c3cc21 |
| InChI | InChI=1S/C24H27N5O2/c1-15-23(16(2)31-26-15)24(30)29-9-6-17-12-20-19(13-22(17)29)21(5-7-25-20)28-11-10-27-8-3-4-18(27)14-28/h5,7,12-13,18H,3-4,6,8-11,14H2,1-2H3/t18-/m0/s1 |
| InChIKey | CMGGBWDHWGQECO-SFHVURJKSA-N |
| XLogP | 3.33 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |