C28H27F3N4O — CID 44534238
(E)-1-[8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 44534238) has the molecular formula C28H27F3N4O and a molecular weight of 492.55 g/mol. Its IUPAC name is (E)-1-[8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 44534238 |
| Molecular Formula | C28H27F3N4O |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (E)-1-[8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-3-[4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)N1CCc2cc3nccc(N4CCN5CCC[C@H]5C4)c3cc21 |
| InChI | InChI=1S/C28H27F3N4O/c29-28(30,31)21-6-3-19(4-7-21)5-8-27(36)35-13-10-20-16-24-23(17-26(20)35)25(9-11-32-24)34-15-14-33-12-1-2-22(33)18-34/h3-9,11,16-17,22H,1-2,10,12-15,18H2/b8-5+/t22-/m0/s1 |
| InChIKey | FOKUHXRLJSVNQA-PABBZOGXSA-N |
| XLogP | 5.14 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|