C28H27N5OS — CID 44534240
[8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(5-pyridin-2-ylthiophen-2-yl)methanone (PubChem CID 44534240) has the molecular formula C28H27N5OS and a molecular weight of 481.63 g/mol. Its IUPAC name is [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(5-pyridin-2-ylthiophen-2-yl)methanone.
| Compound Name | [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(5-pyridin-2-ylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 44534240 |
| Molecular Formula | C28H27N5OS |
| Molecular Weight | 481.63 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [8-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2,3-dihydropyrrolo[2,3-g]quinolin-1-yl]-(5-pyridin-2-ylthiophen-2-yl)methanone |
| SMILES | O=C(c1ccc(-c2ccccn2)s1)N1CCc2cc3nccc(N4CCN5CCC[C@H]5C4)c3cc21 |
| InChI | InChI=1S/C28H27N5OS/c34-28(27-7-6-26(35-27)22-5-1-2-10-29-22)33-13-9-19-16-23-21(17-25(19)33)24(8-11-30-23)32-15-14-31-12-3-4-20(31)18-32/h1-2,5-8,10-11,16-17,20H,3-4,9,12-15,18H2/t20-/m0/s1 |
| InChIKey | UXFJNCWTMMBXIF-FQEVSTJZSA-N |
| XLogP | 4.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |