C26H23Cl2FN4O — CID 44534280
N-(1-benzylpiperidin-4-yl)-4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-fluorobenzamide (PubChem CID 44534280) has the molecular formula C26H23Cl2FN4O and a molecular weight of 497.40 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-fluorobenzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 44534280 |
| Molecular Formula | C26H23Cl2FN4O |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4-(5,6-dichloro-1H-benzimidazol-2-yl)-3-fluorobenzamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1ccc(-c2nc3cc(Cl)c(Cl)cc3[nH]2)c(F)c1 |
| InChI | InChI=1S/C26H23Cl2FN4O/c27-20-13-23-24(14-21(20)28)32-25(31-23)19-7-6-17(12-22(19)29)26(34)30-18-8-10-33(11-9-18)15-16-4-2-1-3-5-16/h1-7,12-14,18H,8-11,15H2,(H,30,34)(H,31,32) |
| InChIKey | GVPAKFSECRAWAN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |