C27H30ClF3N2O4 — CID 44534296
3-[4-[[[3-(4-chlorophenoxy)phenyl]methylamino]methyl]phenoxy]-N,N-dimethylpropan-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 44534296) has the molecular formula C27H30ClF3N2O4 and a molecular weight of 538.99 g/mol. Its IUPAC name is 3-[4-[[[3-(4-chlorophenoxy)phenyl]methylamino]methyl]phenoxy]-N,N-dimethylpropan-1-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-[[[3-(4-chlorophenoxy)phenyl]methylamino]methyl]phenoxy]-N,N-dimethylpropan-1-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44534296 |
| Molecular Formula | C27H30ClF3N2O4 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 3-[4-[[[3-(4-chlorophenoxy)phenyl]methylamino]methyl]phenoxy]-N,N-dimethylpropan-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCCOc1ccc(CNCc2cccc(Oc3ccc(Cl)cc3)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H29ClN2O2.C2HF3O2/c1-28(2)15-4-16-29-23-11-7-20(8-12-23)18-27-19-21-5-3-6-25(17-21)30-24-13-9-22(26)10-14-24;3-2(4,5)1(6)7/h3,5-14,17,27H,4,15-16,18-19H2,1-2H3;(H,6,7) |
| InChIKey | CVEIYCUZWZIOKB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|