C29H32Cl2N2O2 — CID 44534462
(E)-N-[4-[[4-(1-benzofuran-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 44534462) has the molecular formula C29H32Cl2N2O2 and a molecular weight of 511.49 g/mol. Its IUPAC name is (E)-N-[4-[[4-(1-benzofuran-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[[4-(1-benzofuran-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44534462 |
| Molecular Formula | C29H32Cl2N2O2 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | (E)-N-[4-[[4-(1-benzofuran-3-yl)piperidin-1-yl]methyl]cyclohexyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NC1CCC(CN2CCC(c3coc4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C29H32Cl2N2O2/c30-26-11-7-20(17-27(26)31)8-12-29(34)32-23-9-5-21(6-10-23)18-33-15-13-22(14-16-33)25-19-35-28-4-2-1-3-24(25)28/h1-4,7-8,11-12,17,19,21-23H,5-6,9-10,13-16,18H2,(H,32,34)/b12-8+ |
| InChIKey | FZQXELWXZNSPGV-XYOKQWHBSA-N |
| XLogP | 7.31 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|