C29H32Cl2F3N3O4 — CID 44534471
3,4-dichloro-N-[(3S)-1-[[4-[3-(dimethylamino)propoxy]naphthalen-1-yl]methyl]pyrrolidin-3-yl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 44534471) has the molecular formula C29H32Cl2F3N3O4 and a molecular weight of 614.49 g/mol. Its IUPAC name is 3,4-dichloro-N-[(3S)-1-[[4-[3-(dimethylamino)propoxy]naphthalen-1-yl]methyl]pyrrolidin-3-yl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3,4-dichloro-N-[(3S)-1-[[4-[3-(dimethylamino)propoxy]naphthalen-1-yl]methyl]pyrrolidin-3-yl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44534471 |
| Molecular Formula | C29H32Cl2F3N3O4 |
| Molecular Weight | 614.49 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | 3,4-dichloro-N-[(3S)-1-[[4-[3-(dimethylamino)propoxy]naphthalen-1-yl]methyl]pyrrolidin-3-yl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCCOc1ccc(CN2CC[C@H](NC(=O)c3ccc(Cl)c(Cl)c3)C2)c2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H31Cl2N3O2.C2HF3O2/c1-31(2)13-5-15-34-26-11-9-20(22-6-3-4-7-23(22)26)17-32-14-12-21(18-32)30-27(33)19-8-10-24(28)25(29)16-19;3-2(4,5)1(6)7/h3-4,6-11,16,21H,5,12-15,17-18H2,1-2H3,(H,30,33);(H,6,7)/t21-;/m0./s1 |
| InChIKey | MFBBPIXHWARDJD-BOXHHOBZSA-N |
| XLogP | 6.11 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|