About 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol
4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol (PubChem CID 44534571) has the molecular formula C24H30N2O2
and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol.
Molecular Properties
| Compound Name | 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol |
| PubChem CID | 44534571 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol |
| SMILES | CC[C@H]1CN(Cc2ccco2)CC[C@H]1CCCc1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C24H30N2O2/c1-2-18-16-26(17-22-7-4-14-28-22)13-11-19(18)5-3-6-20-10-12-25-24-9-8-21(27)15-23(20)24/h4,7-10,12,14-15,18-19,27H,2-3,5-6,11,13,16-17H2,1H3/t18-,19+/m0/s1 |
| InChIKey | JSORVKKQORKVRP-RBUKOAKNSA-N |
| XLogP | 5.40 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol?
The IUPAC name of 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol (CID 44534571) is 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol.
What is the SMILES notation for 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol?
The canonical SMILES for 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol is CC[C@H]1CN(Cc2ccco2)CC[C@H]1CCCc1ccnc2ccc(O)cc12.
What is the InChIKey of 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol?
The InChIKey is JSORVKKQORKVRP-RBUKOAKNSA-N. The full InChI is InChI=1S/C24H30N2O2/c1-2-18-16-26(17-22-7-4-14-28-22)13-11-19(18)5-3-6-20-10-12-25-24-9-8-21(27)15-23(20)24/h4,7-10,12,14-15,18-19,27H,2-3,5-6,11,13,16-17H2,1H3/t18-,19+/m0/s1.
What are the key properties of 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol?
4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol has a molecular weight of 378.52 g/mol, XLogP of 5.40, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(3R,4R)-3-ethyl-1-(furan-2-ylmethyl)piperidin-4-yl]propyl]quinolin-6-ol is sourced from PubChem (CID 44534571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).