C27H42N2O6 — CID 44534575
1-O-tert-butyl 3-O-ethyl (3R,4R)-4-[hexyl(phenylmethoxycarbonyl)amino]piperidine-1,3-dicarboxylate (PubChem CID 44534575) has the molecular formula C27H42N2O6 and a molecular weight of 490.64 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl (3R,4R)-4-[hexyl(phenylmethoxycarbonyl)amino]piperidine-1,3-dicarboxylate.
| Compound Name | 1-O-tert-butyl 3-O-ethyl (3R,4R)-4-[hexyl(phenylmethoxycarbonyl)amino]piperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 44534575 |
| Molecular Formula | C27H42N2O6 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl (3R,4R)-4-[hexyl(phenylmethoxycarbonyl)amino]piperidine-1,3-dicarboxylate |
| SMILES | CCCCCCN(C(=O)OCc1ccccc1)[C@@H]1CCN(C(=O)OC(C)(C)C)C[C@H]1C(=O)OCC |
| InChI | InChI=1S/C27H42N2O6/c1-6-8-9-13-17-29(26(32)34-20-21-14-11-10-12-15-21)23-16-18-28(25(31)35-27(3,4)5)19-22(23)24(30)33-7-2/h10-12,14-15,22-23H,6-9,13,16-20H2,1-5H3/t22-,23-/m1/s1 |
| InChIKey | GRMYUNGLGXYWEX-DHIUTWEWSA-N |
| XLogP | 5.39 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|