C26H29F3N2O4 — CID 44534734
4-methoxy-N-[[3-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]aniline;2,2,2-trifluoroacetic acid (PubChem CID 44534734) has the molecular formula C26H29F3N2O4 and a molecular weight of 490.52 g/mol. Its IUPAC name is 4-methoxy-N-[[3-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]aniline;2,2,2-trifluoroacetic acid.
| Compound Name | 4-methoxy-N-[[3-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]aniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44534734 |
| Molecular Formula | C26H29F3N2O4 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 4-methoxy-N-[[3-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]aniline;2,2,2-trifluoroacetic acid |
| SMILES | COCCNCc1ccc(-c2cccc(CNc3ccc(OC)cc3)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H28N2O2.C2HF3O2/c1-27-15-14-25-17-19-6-8-21(9-7-19)22-5-3-4-20(16-22)18-26-23-10-12-24(28-2)13-11-23;3-2(4,5)1(6)7/h3-13,16,25-26H,14-15,17-18H2,1-2H3;(H,6,7) |
| InChIKey | APJMLBOWOITQKO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|