C31H31F3N2O3 — CID 44534736
4-methoxy-N-[[3-[3-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]aniline;2,2,2-trifluoroacetic acid (PubChem CID 44534736) has the molecular formula C31H31F3N2O3 and a molecular weight of 536.59 g/mol. Its IUPAC name is 4-methoxy-N-[[3-[3-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]aniline;2,2,2-trifluoroacetic acid.
| Compound Name | 4-methoxy-N-[[3-[3-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]aniline;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44534736 |
| Molecular Formula | C31H31F3N2O3 |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 4-methoxy-N-[[3-[3-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]aniline;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(NCc2cccc(-c3cccc(CNCCc4ccccc4)c3)c2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H30N2O.C2HF3O2/c1-32-29-15-13-28(14-16-29)31-22-25-10-6-12-27(20-25)26-11-5-9-24(19-26)21-30-18-17-23-7-3-2-4-8-23;3-2(4,5)1(6)7/h2-16,19-20,30-31H,17-18,21-22H2,1H3;(H,6,7) |
| InChIKey | ZNEJUGHKMIZYKB-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|