C31H38F3N3O3 — CID 44534746
1-benzyl-N-[[4-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 44534746) has the molecular formula C31H38F3N3O3 and a molecular weight of 557.66 g/mol. Its IUPAC name is 1-benzyl-N-[[4-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-benzyl-N-[[4-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44534746 |
| Molecular Formula | C31H38F3N3O3 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | 1-benzyl-N-[[4-[4-[(2-methoxyethylamino)methyl]phenyl]phenyl]methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | COCCNCc1ccc(-c2ccc(CNC3CCN(Cc4ccccc4)CC3)cc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H37N3O.C2HF3O2/c1-33-20-17-30-21-24-7-11-27(12-8-24)28-13-9-25(10-14-28)22-31-29-15-18-32(19-16-29)23-26-5-3-2-4-6-26;3-2(4,5)1(6)7/h2-14,29-31H,15-23H2,1H3;(H,6,7) |
| InChIKey | MOJRESSSDVCUIU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|