C30H35F3N2O3 — CID 44534752
N-[[3-[4-[[2-(3-methoxyphenyl)ethylamino]methyl]phenyl]phenyl]methyl]cyclopentanamine;2,2,2-trifluoroacetic acid (PubChem CID 44534752) has the molecular formula C30H35F3N2O3 and a molecular weight of 528.62 g/mol. Its IUPAC name is N-[[3-[4-[[2-(3-methoxyphenyl)ethylamino]methyl]phenyl]phenyl]methyl]cyclopentanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[3-[4-[[2-(3-methoxyphenyl)ethylamino]methyl]phenyl]phenyl]methyl]cyclopentanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44534752 |
| Molecular Formula | C30H35F3N2O3 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | N-[[3-[4-[[2-(3-methoxyphenyl)ethylamino]methyl]phenyl]phenyl]methyl]cyclopentanamine;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(CCNCc2ccc(-c3cccc(CNC4CCCC4)c3)cc2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H34N2O.C2HF3O2/c1-31-28-11-5-6-22(19-28)16-17-29-20-23-12-14-25(15-13-23)26-8-4-7-24(18-26)21-30-27-9-2-3-10-27;3-2(4,5)1(6)7/h4-8,11-15,18-19,27,29-30H,2-3,9-10,16-17,20-21H2,1H3;(H,6,7) |
| InChIKey | ASBGFHPTUFQOPK-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|