C26H32N4O7 — CID 44534879
(1R)-1-(6-methoxyquinolin-4-yl)-2-[4-(2-pyridin-4-yloxyethylamino)piperidin-1-yl]ethanol;oxalic acid (PubChem CID 44534879) has the molecular formula C26H32N4O7 and a molecular weight of 512.56 g/mol. Its IUPAC name is (1R)-1-(6-methoxyquinolin-4-yl)-2-[4-(2-pyridin-4-yloxyethylamino)piperidin-1-yl]ethanol;oxalic acid.
| Compound Name | (1R)-1-(6-methoxyquinolin-4-yl)-2-[4-(2-pyridin-4-yloxyethylamino)piperidin-1-yl]ethanol;oxalic acid |
|---|---|
| PubChem CID | 44534879 |
| Molecular Formula | C26H32N4O7 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (1R)-1-(6-methoxyquinolin-4-yl)-2-[4-(2-pyridin-4-yloxyethylamino)piperidin-1-yl]ethanol;oxalic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CN3CCC(NCCOc4ccncc4)CC3)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H30N4O3.C2H2O4/c1-30-20-2-3-23-22(16-20)21(6-11-27-23)24(29)17-28-13-7-18(8-14-28)26-12-15-31-19-4-9-25-10-5-19;3-1(4)2(5)6/h2-6,9-11,16,18,24,26,29H,7-8,12-15,17H2,1H3;(H,3,4)(H,5,6)/t24-;/m0./s1 |
| InChIKey | PXAIFCXXSLQNFZ-JIDHJSLPSA-N |
| XLogP | 1.96 |
| TPSA | 154.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|