C25H27F2N5O7 — CID 44535050
4-[2-(3,5-difluorophenoxy)ethylamino]-N-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-1-carboxamide;oxalic acid (PubChem CID 44535050) has the molecular formula C25H27F2N5O7 and a molecular weight of 547.52 g/mol. Its IUPAC name is 4-[2-(3,5-difluorophenoxy)ethylamino]-N-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-1-carboxamide;oxalic acid.
| Compound Name | 4-[2-(3,5-difluorophenoxy)ethylamino]-N-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-1-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 44535050 |
| Molecular Formula | C25H27F2N5O7 |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 547.19 |
| IUPAC Name | 4-[2-(3,5-difluorophenoxy)ethylamino]-N-(6-methoxy-1,5-naphthyridin-4-yl)piperidine-1-carboxamide;oxalic acid |
| SMILES | COc1ccc2nccc(NC(=O)N3CCC(NCCOc4cc(F)cc(F)c4)CC3)c2n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H25F2N5O3.C2H2O4/c1-32-21-3-2-19-22(29-21)20(4-7-27-19)28-23(31)30-9-5-17(6-10-30)26-8-11-33-18-13-15(24)12-16(25)14-18;3-1(4)2(5)6/h2-4,7,12-14,17,26H,5-6,8-11H2,1H3,(H,27,28,31);(H,3,4)(H,5,6) |
| InChIKey | KRNCYAPQJWWUTM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 163.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|