C28H35N3O7 — CID 44535106
1-[[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]-3-phenylpropan-2-ol;oxalic acid (PubChem CID 44535106) has the molecular formula C28H35N3O7 and a molecular weight of 525.60 g/mol. Its IUPAC name is 1-[[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]-3-phenylpropan-2-ol;oxalic acid.
| Compound Name | 1-[[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]-3-phenylpropan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 44535106 |
| Molecular Formula | C28H35N3O7 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | 1-[[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]amino]-3-phenylpropan-2-ol;oxalic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CN3CCC(NCC(O)Cc4ccccc4)CC3)c2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H33N3O3.C2H2O4/c1-32-22-7-8-25-24(16-22)23(9-12-27-25)26(31)18-29-13-10-20(11-14-29)28-17-21(30)15-19-5-3-2-4-6-19;3-1(4)2(5)6/h2-9,12,16,20-21,26,28,30-31H,10-11,13-15,17-18H2,1H3;(H,3,4)(H,5,6)/t21?,26-;/m0./s1 |
| InChIKey | JOVZVZCKCVMEHD-CMNLWRAASA-N |
| XLogP | 2.09 |
| TPSA | 152.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|