C33H30F3N3O2 — CID 44535143
N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]quinolin-6-amine;2,2,2-trifluoroacetic acid (PubChem CID 44535143) has the molecular formula C33H30F3N3O2 and a molecular weight of 557.62 g/mol. Its IUPAC name is N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]quinolin-6-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]quinolin-6-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44535143 |
| Molecular Formula | C33H30F3N3O2 |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | N-[[4-[4-[(2-phenylethylamino)methyl]phenyl]phenyl]methyl]quinolin-6-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(CCNCc2ccc(-c3ccc(CNc4ccc5ncccc5c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H29N3.C2HF3O2/c1-2-5-24(6-3-1)18-20-32-22-25-8-12-27(13-9-25)28-14-10-26(11-15-28)23-34-30-16-17-31-29(21-30)7-4-19-33-31;3-2(4,5)1(6)7/h1-17,19,21,32,34H,18,20,22-23H2;(H,6,7) |
| InChIKey | MBACOGILOZEYHK-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|