C28H35N3O3 — CID 44535562
4-butyl-N-[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]benzamide (PubChem CID 44535562) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 4-butyl-N-[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]benzamide.
| Compound Name | 4-butyl-N-[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 44535562 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 4-butyl-N-[1-[(2R)-2-hydroxy-2-(6-methoxyquinolin-4-yl)ethyl]piperidin-4-yl]benzamide |
| SMILES | CCCCc1ccc(C(=O)NC2CCN(C[C@H](O)c3ccnc4ccc(OC)cc34)CC2)cc1 |
| InChI | InChI=1S/C28H35N3O3/c1-3-4-5-20-6-8-21(9-7-20)28(33)30-22-13-16-31(17-14-22)19-27(32)24-12-15-29-26-11-10-23(34-2)18-25(24)26/h6-12,15,18,22,27,32H,3-5,13-14,16-17,19H2,1-2H3,(H,30,33)/t27-/m0/s1 |
| InChIKey | VASBUBDUEOOKAV-MHZLTWQESA-N |
| XLogP | 4.51 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |