C21H27F3N2 — CID 44535630
N',N'-diethyl-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]propane-1,3-diamine (PubChem CID 44535630) has the molecular formula C21H27F3N2 and a molecular weight of 364.46 g/mol. Its IUPAC name is N',N'-diethyl-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 44535630 |
| Molecular Formula | C21H27F3N2 |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | N',N'-diethyl-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H27F3N2/c1-3-26(4-2)15-5-14-25-16-17-6-8-18(9-7-17)19-10-12-20(13-11-19)21(22,23)24/h6-13,25H,3-5,14-16H2,1-2H3 |
| InChIKey | CIUJZOFJRGHVDD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|