C22H26F3N3O5 — CID 44535785
1-[(4-methoxyphenyl)methyl]-N-[(3-nitrophenyl)methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 44535785) has the molecular formula C22H26F3N3O5 and a molecular weight of 469.46 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-N-[(3-nitrophenyl)methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-N-[(3-nitrophenyl)methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44535785 |
| Molecular Formula | C22H26F3N3O5 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-N-[(3-nitrophenyl)methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2CCC(NCc3cccc([N+](=O)[O-])c3)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H25N3O3.C2HF3O2/c1-26-20-7-5-16(6-8-20)15-22-11-9-18(10-12-22)21-14-17-3-2-4-19(13-17)23(24)25;3-2(4,5)1(6)7/h2-8,13,18,21H,9-12,14-15H2,1H3;(H,6,7) |
| InChIKey | LRLVXAWCLKVRFH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|