C33H42F3N5O3 — CID 44535852
N-[4-[2-tert-butyl-4-(6-methoxynaphthalen-2-yl)-1H-imidazol-5-yl]-2-pyridinyl]-N',N'-diethylbutane-1,4-diamine;2,2,2-trifluoroacetic acid (PubChem CID 44535852) has the molecular formula C33H42F3N5O3 and a molecular weight of 613.73 g/mol. Its IUPAC name is N-[4-[2-tert-butyl-4-(6-methoxynaphthalen-2-yl)-1H-imidazol-5-yl]-2-pyridinyl]-N',N'-diethylbutane-1,4-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-[2-tert-butyl-4-(6-methoxynaphthalen-2-yl)-1H-imidazol-5-yl]-2-pyridinyl]-N',N'-diethylbutane-1,4-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44535852 |
| Molecular Formula | C33H42F3N5O3 |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | N-[4-[2-tert-butyl-4-(6-methoxynaphthalen-2-yl)-1H-imidazol-5-yl]-2-pyridinyl]-N',N'-diethylbutane-1,4-diamine;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)CCCCNc1cc(-c2[nH]c(C(C)(C)C)nc2-c2ccc3cc(OC)ccc3c2)ccn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H41N5O.C2HF3O2/c1-7-36(8-2)18-10-9-16-32-27-21-25(15-17-33-27)29-28(34-30(35-29)31(3,4)5)24-12-11-23-20-26(37-6)14-13-22(23)19-24;3-2(4,5)1(6)7/h11-15,17,19-21H,7-10,16,18H2,1-6H3,(H,32,33)(H,34,35);(H,6,7) |
| InChIKey | ZGNNRJXFUREAGM-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|