C25H29ClN4O — CID 44535918
6-chloro-N-methyl-1'-(2-phenylethyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide (PubChem CID 44535918) has the molecular formula C25H29ClN4O and a molecular weight of 436.99 g/mol. Its IUPAC name is 6-chloro-N-methyl-1'-(2-phenylethyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide.
| Compound Name | 6-chloro-N-methyl-1'-(2-phenylethyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide |
|---|---|
| PubChem CID | 44535918 |
| Molecular Formula | C25H29ClN4O |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 6-chloro-N-methyl-1'-(2-phenylethyl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide |
| SMILES | CNC(=O)C1Cc2c([nH]c3ccc(Cl)cc23)C2(CCN(CCc3ccccc3)CC2)N1 |
| InChI | InChI=1S/C25H29ClN4O/c1-27-24(31)22-16-20-19-15-18(26)7-8-21(19)28-23(20)25(29-22)10-13-30(14-11-25)12-9-17-5-3-2-4-6-17/h2-8,15,22,28-29H,9-14,16H2,1H3,(H,27,31) |
| InChIKey | DXOJASMOJGADFO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |