C29H37FN4O — CID 44535942
1'-benzyl-6-fluoro-N-hexylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide (PubChem CID 44535942) has the molecular formula C29H37FN4O and a molecular weight of 476.64 g/mol. Its IUPAC name is 1'-benzyl-6-fluoro-N-hexylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide.
| Compound Name | 1'-benzyl-6-fluoro-N-hexylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide |
|---|---|
| PubChem CID | 44535942 |
| Molecular Formula | C29H37FN4O |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | 1'-benzyl-6-fluoro-N-hexylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide |
| SMILES | CCCCCCNC(=O)C1Cc2c([nH]c3ccc(F)cc23)C2(CCN(Cc3ccccc3)CC2)N1 |
| InChI | InChI=1S/C29H37FN4O/c1-2-3-4-8-15-31-28(35)26-19-24-23-18-22(30)11-12-25(23)32-27(24)29(33-26)13-16-34(17-14-29)20-21-9-6-5-7-10-21/h5-7,9-12,18,26,32-33H,2-4,8,13-17,19-20H2,1H3,(H,31,35) |
| InChIKey | YKSIZDKRNXLLNN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|