C29H37FN4O — CID 44535943
1'-benzyl-6-fluoro-N-(4-methylpentan-2-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide (PubChem CID 44535943) has the molecular formula C29H37FN4O and a molecular weight of 476.64 g/mol. Its IUPAC name is 1'-benzyl-6-fluoro-N-(4-methylpentan-2-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide.
| Compound Name | 1'-benzyl-6-fluoro-N-(4-methylpentan-2-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide |
|---|---|
| PubChem CID | 44535943 |
| Molecular Formula | C29H37FN4O |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | 1'-benzyl-6-fluoro-N-(4-methylpentan-2-yl)spiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide |
| SMILES | CC(C)CC(C)NC(=O)C1Cc2c([nH]c3ccc(F)cc23)C2(CCN(Cc3ccccc3)CC2)N1 |
| InChI | InChI=1S/C29H37FN4O/c1-19(2)15-20(3)31-28(35)26-17-24-23-16-22(30)9-10-25(23)32-27(24)29(33-26)11-13-34(14-12-29)18-21-7-5-4-6-8-21/h4-10,16,19-20,26,32-33H,11-15,17-18H2,1-3H3,(H,31,35) |
| InChIKey | WTGIXBQJKVQYBC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |