C23H34ClF3N2O2 — CID 44535997
2-(2-chlorophenyl)-N-[[1-(cyclohexylmethyl)piperidin-4-yl]methyl]ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 44535997) has the molecular formula C23H34ClF3N2O2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[[1-(cyclohexylmethyl)piperidin-4-yl]methyl]ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(2-chlorophenyl)-N-[[1-(cyclohexylmethyl)piperidin-4-yl]methyl]ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44535997 |
| Molecular Formula | C23H34ClF3N2O2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[[1-(cyclohexylmethyl)piperidin-4-yl]methyl]ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | Clc1ccccc1CCNCC1CCN(CC2CCCCC2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H33ClN2.C2HF3O2/c22-21-9-5-4-8-20(21)10-13-23-16-18-11-14-24(15-12-18)17-19-6-2-1-3-7-19;3-2(4,5)1(6)7/h4-5,8-9,18-19,23H,1-3,6-7,10-17H2;(H,6,7) |
| InChIKey | ZHNXEPKQOAKCDL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|