C23H33Cl2F3N2O2 — CID 44536001
N-[[1-(cyclohexylmethyl)piperidin-4-yl]methyl]-2-(2,6-dichlorophenyl)ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 44536001) has the molecular formula C23H33Cl2F3N2O2 and a molecular weight of 497.43 g/mol. Its IUPAC name is N-[[1-(cyclohexylmethyl)piperidin-4-yl]methyl]-2-(2,6-dichlorophenyl)ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[1-(cyclohexylmethyl)piperidin-4-yl]methyl]-2-(2,6-dichlorophenyl)ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536001 |
| Molecular Formula | C23H33Cl2F3N2O2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N-[[1-(cyclohexylmethyl)piperidin-4-yl]methyl]-2-(2,6-dichlorophenyl)ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | Clc1cccc(Cl)c1CCNCC1CCN(CC2CCCCC2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H32Cl2N2.C2HF3O2/c22-20-7-4-8-21(23)19(20)9-12-24-15-17-10-13-25(14-11-17)16-18-5-2-1-3-6-18;3-2(4,5)1(6)7/h4,7-8,17-18,24H,1-3,5-6,9-16H2;(H,6,7) |
| InChIKey | GKXFHSBPRHRZRJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|