C30H35F3N2O4 — CID 44536009
N-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2-(2-phenoxyphenyl)ethanamine;2,2,2-trifluoroacetic acid (PubChem CID 44536009) has the molecular formula C30H35F3N2O4 and a molecular weight of 544.61 g/mol. Its IUPAC name is N-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2-(2-phenoxyphenyl)ethanamine;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2-(2-phenoxyphenyl)ethanamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536009 |
| Molecular Formula | C30H35F3N2O4 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | N-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]methyl]-2-(2-phenoxyphenyl)ethanamine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(CN2CCC(CNCCc3ccccc3Oc3ccccc3)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H34N2O2.C2HF3O2/c1-31-26-13-11-24(12-14-26)22-30-19-16-23(17-20-30)21-29-18-15-25-7-5-6-10-28(25)32-27-8-3-2-4-9-27;3-2(4,5)1(6)7/h2-14,23,29H,15-22H2,1H3;(H,6,7) |
| InChIKey | WOTBVPKQUXUSCB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|