C23H24F3N7O5 — CID 44536037
2-[[2-[4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]phenol;2,2,2-trifluoroacetic acid (PubChem CID 44536037) has the molecular formula C23H24F3N7O5 and a molecular weight of 535.48 g/mol. Its IUPAC name is 2-[[2-[4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]phenol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[2-[4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]phenol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536037 |
| Molecular Formula | C23H24F3N7O5 |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 2-[[2-[4-(4-methylpiperazin-1-yl)anilino]-5-nitropyrimidin-4-yl]amino]phenol;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCN(c2ccc(Nc3ncc([N+](=O)[O-])c(Nc4ccccc4O)n3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23N7O3.C2HF3O2/c1-26-10-12-27(13-11-26)16-8-6-15(7-9-16)23-21-22-14-18(28(30)31)20(25-21)24-17-4-2-3-5-19(17)29;3-2(4,5)1(6)7/h2-9,14,29H,10-13H2,1H3,(H2,22,23,24,25);(H,6,7) |
| InChIKey | XPFLWMBTDBWRGL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|