C28H32F3N3O4 — CID 44536295
N-(2-methoxyethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]benzamide;2,2,2-trifluoroacetic acid (PubChem CID 44536295) has the molecular formula C28H32F3N3O4 and a molecular weight of 531.58 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]benzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2-methoxyethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]benzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536295 |
| Molecular Formula | C28H32F3N3O4 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | N-(2-methoxyethyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]benzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCNCc1ccc(-c2ccc(CN(CCOC)C(=O)c3ccccc3)cc2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H31N3O2.C2HF3O2/c1-3-15-27-18-22-11-14-25(28-19-22)23-12-9-21(10-13-23)20-29(16-17-31-2)26(30)24-7-5-4-6-8-24;3-2(4,5)1(6)7/h4-14,19,27H,3,15-18,20H2,1-2H3;(H,6,7) |
| InChIKey | DKINYURKOGCVFI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|