C31H36F3N3O4 — CID 44536307
(E)-N-(2-methoxyethyl)-3-(2-methylphenyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]prop-2-enamide;2,2,2-trifluoroacetic acid (PubChem CID 44536307) has the molecular formula C31H36F3N3O4 and a molecular weight of 571.64 g/mol. Its IUPAC name is (E)-N-(2-methoxyethyl)-3-(2-methylphenyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]prop-2-enamide;2,2,2-trifluoroacetic acid.
| Compound Name | (E)-N-(2-methoxyethyl)-3-(2-methylphenyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]prop-2-enamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536307 |
| Molecular Formula | C31H36F3N3O4 |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | (E)-N-(2-methoxyethyl)-3-(2-methylphenyl)-N-[[4-[5-(propylaminomethyl)-2-pyridinyl]phenyl]methyl]prop-2-enamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCNCc1ccc(-c2ccc(CN(CCOC)C(=O)/C=C/c3ccccc3C)cc2)nc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H35N3O2.C2HF3O2/c1-4-17-30-20-25-11-15-28(31-21-25)27-12-9-24(10-13-27)22-32(18-19-34-3)29(33)16-14-26-8-6-5-7-23(26)2;3-2(4,5)1(6)7/h5-16,21,30H,4,17-20,22H2,1-3H3;(H,6,7)/b16-14+; |
| InChIKey | SXENPWQLLPKNLC-BACBYAOASA-N |
| XLogP | 5.88 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|