C35H39F3N4O2 — CID 44536465
1-benzyl-N-[[4-[5-[(2-phenylethylamino)methyl]-2-pyridinyl]phenyl]methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 44536465) has the molecular formula C35H39F3N4O2 and a molecular weight of 604.72 g/mol. Its IUPAC name is 1-benzyl-N-[[4-[5-[(2-phenylethylamino)methyl]-2-pyridinyl]phenyl]methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-benzyl-N-[[4-[5-[(2-phenylethylamino)methyl]-2-pyridinyl]phenyl]methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44536465 |
| Molecular Formula | C35H39F3N4O2 |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | 1-benzyl-N-[[4-[5-[(2-phenylethylamino)methyl]-2-pyridinyl]phenyl]methyl]piperidin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ccc(CCNCc2ccc(-c3ccc(CNC4CCN(Cc5ccccc5)CC4)cc3)nc2)cc1 |
| InChI | InChI=1S/C33H38N4.C2HF3O2/c1-3-7-27(8-4-1)17-20-34-23-30-13-16-33(36-25-30)31-14-11-28(12-15-31)24-35-32-18-21-37(22-19-32)26-29-9-5-2-6-10-29;3-2(4,5)1(6)7/h1-16,25,32,34-35H,17-24,26H2;(H,6,7) |
| InChIKey | ATASNEUGCYWPEZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|